C19H37NaO10S — CID 135390957
sodium 3-[[(2R,3S,4S,5R)-6-decoxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-2-hydroxypropane-1-sulfonate (PubChem CID 135390957) has the molecular formula C19H37NaO10S and a molecular weight of 480.55 g/mol. Its IUPAC name is sodium 3-[[(2R,3S,4S,5R)-6-decoxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-2-hydroxypropane-1-sulfonate.
| Compound Name | sodium 3-[[(2R,3S,4S,5R)-6-decoxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-2-hydroxypropane-1-sulfonate |
|---|---|
| PubChem CID | 135390957 |
| Molecular Formula | C19H37NaO10S |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | sodium 3-[[(2R,3S,4S,5R)-6-decoxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-2-hydroxypropane-1-sulfonate |
| SMILES | CCCCCCCCCCOC1O[C@H](COCC(O)CS(=O)(=O)[O-])[C@@H](O)[C@H](O)[C@H]1O.[Na+] |
| InChI | InChI=1S/C19H38O10S.Na/c1-2-3-4-5-6-7-8-9-10-28-19-18(23)17(22)16(21)15(29-19)12-27-11-14(20)13-30(24,25)26;/h14-23H,2-13H2,1H3,(H,24,25,26);/q;+1/p-1/t14?,15-,16-,17+,18-,19?;/m1./s1 |
| InChIKey | GETNEUYTCYYHAM-GPOUTCDUSA-M |
| XLogP | -3.12 |
| TPSA | 165.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | -3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|