C11H13BrClNO2 — CID 135396806
propan-2-yl 2-bromo-5-chloro-4,6-dimethylpyridine-3-carboxylate (PubChem CID 135396806) has the molecular formula C11H13BrClNO2 and a molecular weight of 306.59 g/mol. Its IUPAC name is propan-2-yl 2-bromo-5-chloro-4,6-dimethylpyridine-3-carboxylate.
| Compound Name | propan-2-yl 2-bromo-5-chloro-4,6-dimethylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 135396806 |
| Molecular Formula | C11H13BrClNO2 |
| Molecular Weight | 306.59 g/mol |
| Exact Mass | 304.98 |
| IUPAC Name | propan-2-yl 2-bromo-5-chloro-4,6-dimethylpyridine-3-carboxylate |
| SMILES | Cc1nc(Br)c(C(=O)OC(C)C)c(C)c1Cl |
| InChI | InChI=1S/C11H13BrClNO2/c1-5(2)16-11(15)8-6(3)9(13)7(4)14-10(8)12/h5H,1-4H3 |
| InChIKey | FYUUITKNRUIRLT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.59 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|