About dipyridinosilole
dipyridinosilole (PubChem CID 135397782) has the molecular formula C10H6N2Si
and a molecular weight of 182.26 g/mol.
Molecular Properties
| Compound Name | dipyridinosilole |
| PubChem CID | 135397782 |
| Molecular Formula | C10H6N2Si |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.03 |
| IUPAC Name | — |
| SMILES | c1cnc2c(c1)[Si]c1ncccc1-2 |
| InChI | InChI=1S/C10H6N2Si/c1-3-7-9-8(4-2-5-11-9)13-10(7)12-6-1/h1-6H |
| InChIKey | MFPWYBFHJBUAMI-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dipyridinosilole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipyridinosilole?
The IUPAC name of dipyridinosilole (CID 135397782) is not available.
What is the SMILES notation for dipyridinosilole?
The canonical SMILES for dipyridinosilole is c1cnc2c(c1)[Si]c1ncccc1-2.
What is the InChIKey of dipyridinosilole?
The InChIKey is MFPWYBFHJBUAMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N2Si/c1-3-7-9-8(4-2-5-11-9)13-10(7)12-6-1/h1-6H.
What are the key properties of dipyridinosilole?
dipyridinosilole has a molecular weight of 182.26 g/mol, XLogP of 0.11, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dipyridinosilole is sourced from PubChem (CID 135397782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).