C20H22N8O6 — CID 135407898
N-[9-[(2R,3R,4S,5R)-4-(azidomethyl)-3-hydroxy-5-(2-hydroxyethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-phenoxyacetamide (PubChem CID 135407898) has the molecular formula C20H22N8O6 and a molecular weight of 470.45 g/mol. Its IUPAC name is N-[9-[(2R,3R,4S,5R)-4-(azidomethyl)-3-hydroxy-5-(2-hydroxyethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-phenoxyacetamide.
| Compound Name | N-[9-[(2R,3R,4S,5R)-4-(azidomethyl)-3-hydroxy-5-(2-hydroxyethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 135407898 |
| Molecular Formula | C20H22N8O6 |
| Molecular Weight | 470.45 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | N-[9-[(2R,3R,4S,5R)-4-(azidomethyl)-3-hydroxy-5-(2-hydroxyethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-2-phenoxyacetamide |
| SMILES | [N-]=[N+]=NC[C@H]1[C@@H](O)[C@H](n2cnc3c(=O)[nH]c(NC(=O)COc4ccccc4)nc32)O[C@@H]1CCO |
| InChI | InChI=1S/C20H22N8O6/c21-27-23-8-12-13(6-7-29)34-19(16(12)31)28-10-22-15-17(28)25-20(26-18(15)32)24-14(30)9-33-11-4-2-1-3-5-11/h1-5,10,12-13,16,19,29,31H,6-9H2,(H2,24,25,26,30,32)/t12-,13-,16-,19-/m1/s1 |
| InChIKey | SNDAJAPLDCKNOI-XBQLXHJASA-N |
| XLogP | 0.70 |
| TPSA | 200.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.45 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|