C12H13Cl2N5O2S — CID 135408641
(5,7-dichloro-2-hydroxy-1H-indol-3-yl)iminothiourea;N,N-dimethylformamide (PubChem CID 135408641) has the molecular formula C12H13Cl2N5O2S and a molecular weight of 362.24 g/mol. Its IUPAC name is (5,7-dichloro-2-hydroxy-1H-indol-3-yl)iminothiourea;N,N-dimethylformamide.
| Compound Name | (5,7-dichloro-2-hydroxy-1H-indol-3-yl)iminothiourea;N,N-dimethylformamide |
|---|---|
| PubChem CID | 135408641 |
| Molecular Formula | C12H13Cl2N5O2S |
| Molecular Weight | 362.24 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | (5,7-dichloro-2-hydroxy-1H-indol-3-yl)iminothiourea;N,N-dimethylformamide |
| SMILES | CN(C)C=O.NC(=S)/N=N/c1c(O)[nH]c2c(Cl)cc(Cl)cc12 |
| InChI | InChI=1S/C9H6Cl2N4OS.C3H7NO/c10-3-1-4-6(5(11)2-3)13-8(16)7(4)14-15-9(12)17;1-4(2)3-5/h1-2,13,16H,(H2,12,17);3H,1-2H3/b15-14+; |
| InChIKey | AEUMNSVPGHFQAM-WPDLWGESSA-N |
| XLogP | 3.21 |
| TPSA | 107.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.24 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|