C10H18N6O2 — CID 135438153
N'-(3-amino-5-oxo-4H-1,2,4-triazin-6-yl)heptanehydrazide (PubChem CID 135438153) has the molecular formula C10H18N6O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is N'-(3-amino-5-oxo-4H-1,2,4-triazin-6-yl)heptanehydrazide.
| Compound Name | N'-(3-amino-5-oxo-4H-1,2,4-triazin-6-yl)heptanehydrazide |
|---|---|
| PubChem CID | 135438153 |
| Molecular Formula | C10H18N6O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | N'-(3-amino-5-oxo-4H-1,2,4-triazin-6-yl)heptanehydrazide |
| SMILES | CCCCCCC(=O)NNc1nnc(N)[nH]c1=O |
| InChI | InChI=1S/C10H18N6O2/c1-2-3-4-5-6-7(17)13-14-8-9(18)12-10(11)16-15-8/h2-6H2,1H3,(H,13,17)(H,14,15)(H3,11,12,16,18) |
| InChIKey | YQHJZYCGOJSWGY-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|