C23H22N2O5 — CID 135454103
ethyl (E)-2-[[2-(1,3-dioxoisoindol-2-yl)phenyl]iminomethyl]-3-hydroxyhex-2-enoate (PubChem CID 135454103) has the molecular formula C23H22N2O5 and a molecular weight of 406.44 g/mol. Its IUPAC name is ethyl (E)-2-[[2-(1,3-dioxoisoindol-2-yl)phenyl]iminomethyl]-3-hydroxyhex-2-enoate.
| Compound Name | ethyl (E)-2-[[2-(1,3-dioxoisoindol-2-yl)phenyl]iminomethyl]-3-hydroxyhex-2-enoate |
|---|---|
| PubChem CID | 135454103 |
| Molecular Formula | C23H22N2O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | ethyl (E)-2-[[2-(1,3-dioxoisoindol-2-yl)phenyl]iminomethyl]-3-hydroxyhex-2-enoate |
| SMILES | CCC/C(O)=C(/C=N/c1ccccc1N1C(=O)c2ccccc2C1=O)C(=O)OCC |
| InChI | InChI=1S/C23H22N2O5/c1-3-9-20(26)17(23(29)30-4-2)14-24-18-12-7-8-13-19(18)25-21(27)15-10-5-6-11-16(15)22(25)28/h5-8,10-14,26H,3-4,9H2,1-2H3/b20-17+,24-14+ |
| InChIKey | GXXYSCJKNWVWNI-PSAJCDLISA-N |
| XLogP | 4.36 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|