C42H44N2O4 — CID 135467002
2-methyl-3-[[(1R,2R)-2-[[3-methyl-1,4-dioxo-1-(2,4,6-trimethylphenyl)but-2-en-2-yl]amino]-1,2-diphenylethyl]amino]-4-oxo-4-(2,4,6-trimethylphenyl)but-2-enal (PubChem CID 135467002) has the molecular formula C42H44N2O4 and a molecular weight of 640.82 g/mol. Its IUPAC name is 2-methyl-3-[[(1R,2R)-2-[[3-methyl-1,4-dioxo-1-(2,4,6-trimethylphenyl)but-2-en-2-yl]amino]-1,2-diphenylethyl]amino]-4-oxo-4-(2,4,6-trimethylphenyl)but-2-enal.
| Compound Name | 2-methyl-3-[[(1R,2R)-2-[[3-methyl-1,4-dioxo-1-(2,4,6-trimethylphenyl)but-2-en-2-yl]amino]-1,2-diphenylethyl]amino]-4-oxo-4-(2,4,6-trimethylphenyl)but-2-enal |
|---|---|
| PubChem CID | 135467002 |
| Molecular Formula | C42H44N2O4 |
| Molecular Weight | 640.82 g/mol |
| Exact Mass | 640.33 |
| IUPAC Name | 2-methyl-3-[[(1R,2R)-2-[[3-methyl-1,4-dioxo-1-(2,4,6-trimethylphenyl)but-2-en-2-yl]amino]-1,2-diphenylethyl]amino]-4-oxo-4-(2,4,6-trimethylphenyl)but-2-enal |
| SMILES | CC(C=O)=C(N[C@H](c1ccccc1)[C@H](NC(C(=O)c1c(C)cc(C)cc1C)=C(C)C=O)c1ccccc1)C(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C42H44N2O4/c1-25-19-27(3)35(28(4)20-25)41(47)37(31(7)23-45)43-39(33-15-11-9-12-16-33)40(34-17-13-10-14-18-34)44-38(32(8)24-46)42(48)36-29(5)21-26(2)22-30(36)6/h9-24,39-40,43-44H,1-8H3/t39-,40-/m1/s1 |
| InChIKey | BSZSGQBBEOGAOZ-XRSDMRJBSA-N |
| XLogP | 8.21 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.82 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|