C33H24N2O11 — CID 135474827
1,9,11,14-tetrahydroxy-3-[(E)-[(2-hydroxybenzoyl)hydrazinylidene]methyl]-7-methoxy-10-methyl-8,13-dioxo-5,6-dihydrobenzo[a]tetracene-2-carboxylic acid (PubChem CID 135474827) has the molecular formula C33H24N2O11 and a molecular weight of 624.56 g/mol. Its IUPAC name is 1,9,11,14-tetrahydroxy-3-[(E)-[(2-hydroxybenzoyl)hydrazinylidene]methyl]-7-methoxy-10-methyl-8,13-dioxo-5,6-dihydrobenzo[a]tetracene-2-carboxylic acid.
| Compound Name | 1,9,11,14-tetrahydroxy-3-[(E)-[(2-hydroxybenzoyl)hydrazinylidene]methyl]-7-methoxy-10-methyl-8,13-dioxo-5,6-dihydrobenzo[a]tetracene-2-carboxylic acid |
|---|---|
| PubChem CID | 135474827 |
| Molecular Formula | C33H24N2O11 |
| Molecular Weight | 624.56 g/mol |
| Exact Mass | 624.14 |
| IUPAC Name | 1,9,11,14-tetrahydroxy-3-[(E)-[(2-hydroxybenzoyl)hydrazinylidene]methyl]-7-methoxy-10-methyl-8,13-dioxo-5,6-dihydrobenzo[a]tetracene-2-carboxylic acid |
| SMILES | COc1c2c(c(O)c3c1C(=O)c1c(cc(O)c(C)c1O)C3=O)-c1c(cc(/C=N/NC(=O)c3ccccc3O)c(C(=O)O)c1O)CC2 |
| InChI | InChI=1S/C33H24N2O11/c1-12-19(37)10-17-23(26(12)38)30(42)25-24(27(17)39)29(41)22-16(31(25)46-2)8-7-13-9-14(21(33(44)45)28(40)20(13)22)11-34-35-32(43)15-5-3-4-6-18(15)36/h3-6,9-11,36-38,40-41H,7-8H2,1-2H3,(H,35,43)(H,44,45)/b34-11+ |
| InChIKey | VXPFDACYGOZPBS-WHQPAHRZSA-N |
| XLogP | 3.53 |
| TPSA | 223.28 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.56 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|