C29H31N4O10P — CID 135480269
[1-(3,5-dimethoxyphenyl)-2-oxo-2-phenylethyl] [(2R,3S,5R)-2-(hydroxymethyl)-5-(6-oxo-1H-purin-9-yl)oxolan-3-yl] prop-2-enyl phosphate (PubChem CID 135480269) has the molecular formula C29H31N4O10P and a molecular weight of 626.56 g/mol. Its IUPAC name is [1-(3,5-dimethoxyphenyl)-2-oxo-2-phenylethyl] [(2R,3S,5R)-2-(hydroxymethyl)-5-(6-oxo-1H-purin-9-yl)oxolan-3-yl] prop-2-enyl phosphate.
| Compound Name | [1-(3,5-dimethoxyphenyl)-2-oxo-2-phenylethyl] [(2R,3S,5R)-2-(hydroxymethyl)-5-(6-oxo-1H-purin-9-yl)oxolan-3-yl] prop-2-enyl phosphate |
|---|---|
| PubChem CID | 135480269 |
| Molecular Formula | C29H31N4O10P |
| Molecular Weight | 626.56 g/mol |
| Exact Mass | 626.18 |
| IUPAC Name | [1-(3,5-dimethoxyphenyl)-2-oxo-2-phenylethyl] [(2R,3S,5R)-2-(hydroxymethyl)-5-(6-oxo-1H-purin-9-yl)oxolan-3-yl] prop-2-enyl phosphate |
| SMILES | C=CCOP(=O)(OC(C(=O)c1ccccc1)c1cc(OC)cc(OC)c1)O[C@H]1C[C@H](n2cnc3c(=O)[nH]cnc32)O[C@@H]1CO |
| InChI | InChI=1S/C29H31N4O10P/c1-4-10-40-44(37,42-22-14-24(41-23(22)15-34)33-17-32-25-28(33)30-16-31-29(25)36)43-27(26(35)18-8-6-5-7-9-18)19-11-20(38-2)13-21(12-19)39-3/h4-9,11-13,16-17,22-24,27,34H,1,10,14-15H2,2-3H3,(H,30,31,36)/t22-,23+,24+,27?,44?/m0/s1 |
| InChIKey | WWGKLDKCORQIPI-SBEVMRCMSA-N |
| XLogP | 3.75 |
| TPSA | 173.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.56 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|