C34H50N3O6S+ — CID 135496773
N,N-dicyclohexyl-1-[(1S,2R,4R)-2-[(4R,6S)-3-(iminomethylidene)-4-(4-methoxyphenyl)-2-oxooxazinan-2-ium-6-yl]oxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methanesulfonamide (PubChem CID 135496773) has the molecular formula C34H50N3O6S+ and a molecular weight of 628.86 g/mol. Its IUPAC name is N,N-dicyclohexyl-1-[(1S,2R,4R)-2-[(4R,6S)-3-(iminomethylidene)-4-(4-methoxyphenyl)-2-oxooxazinan-2-ium-6-yl]oxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methanesulfonamide.
| Compound Name | N,N-dicyclohexyl-1-[(1S,2R,4R)-2-[(4R,6S)-3-(iminomethylidene)-4-(4-methoxyphenyl)-2-oxooxazinan-2-ium-6-yl]oxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methanesulfonamide |
|---|---|
| PubChem CID | 135496773 |
| Molecular Formula | C34H50N3O6S+ |
| Molecular Weight | 628.86 g/mol |
| Exact Mass | 628.34 |
| IUPAC Name | N,N-dicyclohexyl-1-[(1S,2R,4R)-2-[(4R,6S)-3-(iminomethylidene)-4-(4-methoxyphenyl)-2-oxooxazinan-2-ium-6-yl]oxy-7,7-dimethyl-1-bicyclo[2.2.1]heptanyl]methanesulfonamide |
| SMILES | COc1ccc([C@H]2C[C@@H](O[C@@H]3C[C@H]4CC[C@]3(CS(=O)(=O)N(C3CCCCC3)C3CCCCC3)C4(C)C)O[N+](=O)C2=C=N)cc1 |
| InChI | InChI=1S/C34H50N3O6S/c1-33(2)25-18-19-34(33,23-44(39,40)36(26-10-6-4-7-11-26)27-12-8-5-9-13-27)31(20-25)42-32-21-29(30(22-35)37(38)43-32)24-14-16-28(41-3)17-15-24/h14-17,25-27,29,31-32,35H,4-13,18-21,23H2,1-3H3/q+1/t25-,29-,31-,32+,34-/m1/s1 |
| InChIKey | SUGGVECMHSANLQ-SIZPVSJZSA-N |
| XLogP | 6.86 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.86 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|