C31H50N2O8S2 — CID 21217042
2-[[1-[[diazo-[[7,7-dimethyl-2-(oxan-2-yloxy)-1-bicyclo[2.2.1]heptanyl]methylsulfonyl]methyl]sulfonylmethyl]-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl]oxy]oxane (PubChem CID 21217042) has the molecular formula C31H50N2O8S2 and a molecular weight of 642.88 g/mol. Its IUPAC name is 2-[[1-[[diazo-[[7,7-dimethyl-2-(oxan-2-yloxy)-1-bicyclo[2.2.1]heptanyl]methylsulfonyl]methyl]sulfonylmethyl]-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl]oxy]oxane.
| Compound Name | 2-[[1-[[diazo-[[7,7-dimethyl-2-(oxan-2-yloxy)-1-bicyclo[2.2.1]heptanyl]methylsulfonyl]methyl]sulfonylmethyl]-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl]oxy]oxane |
|---|---|
| PubChem CID | 21217042 |
| Molecular Formula | C31H50N2O8S2 |
| Molecular Weight | 642.88 g/mol |
| Exact Mass | 642.30 |
| IUPAC Name | 2-[[1-[[diazo-[[7,7-dimethyl-2-(oxan-2-yloxy)-1-bicyclo[2.2.1]heptanyl]methylsulfonyl]methyl]sulfonylmethyl]-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl]oxy]oxane |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)C(=[N+]=[N-])S(=O)(=O)CC13CCC(CC1OC1CCCCO1)C3(C)C)C(OC1CCCCO1)C2 |
| InChI | InChI=1S/C31H50N2O8S2/c1-28(2)21-11-13-30(28,23(17-21)40-25-9-5-7-15-38-25)19-42(34,35)27(33-32)43(36,37)20-31-14-12-22(29(31,3)4)18-24(31)41-26-10-6-8-16-39-26/h21-26H,5-20H2,1-4H3 |
| InChIKey | XFYKKMAMTYOLTK-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 141.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.88 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|