C17H19ClN10O2S — CID 135508495
4,7-diamino-8-[(4-piperidin-1-ylsulfonylphenyl)diazenyl]pyrazolo[5,1-c][1,2,4]triazine-3-carbonitrile;hydrochloride (PubChem CID 135508495) has the molecular formula C17H19ClN10O2S and a molecular weight of 462.93 g/mol. Its IUPAC name is 4,7-diamino-8-[(4-piperidin-1-ylsulfonylphenyl)diazenyl]pyrazolo[5,1-c][1,2,4]triazine-3-carbonitrile;hydrochloride.
| Compound Name | 4,7-diamino-8-[(4-piperidin-1-ylsulfonylphenyl)diazenyl]pyrazolo[5,1-c][1,2,4]triazine-3-carbonitrile;hydrochloride |
|---|---|
| PubChem CID | 135508495 |
| Molecular Formula | C17H19ClN10O2S |
| Molecular Weight | 462.93 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 4,7-diamino-8-[(4-piperidin-1-ylsulfonylphenyl)diazenyl]pyrazolo[5,1-c][1,2,4]triazine-3-carbonitrile;hydrochloride |
| SMILES | Cl.N#Cc1nnc2c(/N=N/c3ccc(S(=O)(=O)N4CCCCC4)cc3)c(N)nn2c1N |
| InChI | InChI=1S/C17H18N10O2S.ClH/c18-10-13-16(20)27-17(24-22-13)14(15(19)25-27)23-21-11-4-6-12(7-5-11)30(28,29)26-8-2-1-3-9-26;/h4-7H,1-3,8-9,20H2,(H2,19,25);1H/b23-21+; |
| InChIKey | YZUQVQNXDXECOG-FKWCIMQXSA-N |
| XLogP | 2.17 |
| TPSA | 181.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.93 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|