C25H25NO — CID 135511984
6-[[(1R)-1-phenylethyl]iminomethyl]tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaen-5-ol (PubChem CID 135511984) has the molecular formula C25H25NO and a molecular weight of 355.48 g/mol. Its IUPAC name is 6-[[(1R)-1-phenylethyl]iminomethyl]tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaen-5-ol.
| Compound Name | 6-[[(1R)-1-phenylethyl]iminomethyl]tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaen-5-ol |
|---|---|
| PubChem CID | 135511984 |
| Molecular Formula | C25H25NO |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 6-[[(1R)-1-phenylethyl]iminomethyl]tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaen-5-ol |
| SMILES | C[C@@H](/N=C/c1c2ccc(c1O)CCc1ccc(cc1)CC2)c1ccccc1 |
| InChI | InChI=1S/C25H25NO/c1-18(21-5-3-2-4-6-21)26-17-24-22-13-11-19-7-9-20(10-8-19)12-14-23(16-15-22)25(24)27/h2-10,15-18,27H,11-14H2,1H3/b26-17+/t18-/m1/s1 |
| InChIKey | NBISKSHDDKMNRD-WNIQNGNASA-N |
| XLogP | 5.46 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|