C25H22O3 — CID 6422005
1-(6-hydroxy-5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)-3-phenylpropane-1,3-dione (PubChem CID 6422005) has the molecular formula C25H22O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 1-(6-hydroxy-5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)-3-phenylpropane-1,3-dione.
| Compound Name | 1-(6-hydroxy-5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)-3-phenylpropane-1,3-dione |
|---|---|
| PubChem CID | 6422005 |
| Molecular Formula | C25H22O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 1-(6-hydroxy-5-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaenyl)-3-phenylpropane-1,3-dione |
| SMILES | O=C(CC(=O)c1c2ccc(c1O)CCc1ccc(cc1)CC2)c1ccccc1 |
| InChI | InChI=1S/C25H22O3/c26-22(19-4-2-1-3-5-19)16-23(27)24-20-12-10-17-6-8-18(9-7-17)11-13-21(15-14-20)25(24)28/h1-9,14-15,28H,10-13,16H2 |
| InChIKey | NJSGPLNHDPNKHN-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|