C19H19N4O+ — CID 135512169
4-(1,3-dimethylbenzimidazol-3-ium-2-yl)-5-imino-1-phenyl-2H-pyrrol-3-ol (PubChem CID 135512169) has the molecular formula C19H19N4O+ and a molecular weight of 319.39 g/mol. Its IUPAC name is 4-(1,3-dimethylbenzimidazol-3-ium-2-yl)-5-imino-1-phenyl-2H-pyrrol-3-ol.
| Compound Name | 4-(1,3-dimethylbenzimidazol-3-ium-2-yl)-5-imino-1-phenyl-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 135512169 |
| Molecular Formula | C19H19N4O+ |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 4-(1,3-dimethylbenzimidazol-3-ium-2-yl)-5-imino-1-phenyl-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2n(C)c3ccccc3[n+]2C)=C(O)CN1c1ccccc1 |
| InChI | InChI=1S/C19H18N4O/c1-21-14-10-6-7-11-15(14)22(2)19(21)17-16(24)12-23(18(17)20)13-8-4-3-5-9-13/h3-11,20H,12H2,1-2H3/p+1/b20-18- |
| InChIKey | USCYVTFLFANWBL-ZZEZOPTASA-O |
| XLogP | 2.77 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|