C15H19ClN4O — CID 137178581
5-amino-4-(1,3-dimethylbenzimidazol-3-ium-2-yl)-2,2-dimethylpyrrol-3-ol chloride (PubChem CID 137178581) has the molecular formula C15H19ClN4O and a molecular weight of 306.80 g/mol. Its IUPAC name is 5-amino-4-(1,3-dimethylbenzimidazol-3-ium-2-yl)-2,2-dimethylpyrrol-3-ol chloride.
| Compound Name | 5-amino-4-(1,3-dimethylbenzimidazol-3-ium-2-yl)-2,2-dimethylpyrrol-3-ol chloride |
|---|---|
| PubChem CID | 137178581 |
| Molecular Formula | C15H19ClN4O |
| Molecular Weight | 306.80 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 5-amino-4-(1,3-dimethylbenzimidazol-3-ium-2-yl)-2,2-dimethylpyrrol-3-ol chloride |
| SMILES | Cn1c(C2=C(O)C(C)(C)N=C2N)[n+](C)c2ccccc21.[Cl-] |
| InChI | InChI=1S/C15H18N4O.ClH/c1-15(2)12(20)11(13(16)17-15)14-18(3)9-7-5-6-8-10(9)19(14)4;/h5-8H,1-4H3,(H2,16,17);1H |
| InChIKey | AXMLNQBXVFQMQW-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 67.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.80 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|