C19H25ClN4O — CID 137178589
2-amino-3-(1-ethyl-3-methylbenzimidazol-3-ium-2-yl)-1-azaspiro[4.5]deca-1,3-dien-4-ol chloride (PubChem CID 137178589) has the molecular formula C19H25ClN4O and a molecular weight of 360.89 g/mol. Its IUPAC name is 2-amino-3-(1-ethyl-3-methylbenzimidazol-3-ium-2-yl)-1-azaspiro[4.5]deca-1,3-dien-4-ol chloride.
| Compound Name | 2-amino-3-(1-ethyl-3-methylbenzimidazol-3-ium-2-yl)-1-azaspiro[4.5]deca-1,3-dien-4-ol chloride |
|---|---|
| PubChem CID | 137178589 |
| Molecular Formula | C19H25ClN4O |
| Molecular Weight | 360.89 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 2-amino-3-(1-ethyl-3-methylbenzimidazol-3-ium-2-yl)-1-azaspiro[4.5]deca-1,3-dien-4-ol chloride |
| SMILES | CCn1c(C2=C(O)C3(CCCCC3)N=C2N)[n+](C)c2ccccc21.[Cl-] |
| InChI | InChI=1S/C19H24N4O.ClH/c1-3-23-14-10-6-5-9-13(14)22(2)18(23)15-16(24)19(21-17(15)20)11-7-4-8-12-19;/h5-6,9-10H,3-4,7-8,11-12H2,1-2H3,(H2,20,21);1H |
| InChIKey | HZOTXICRNRLXBL-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 67.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.89 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|