C14H17N4O+ — CID 137178588
5-amino-4-(1-ethyl-3-methylbenzimidazol-3-ium-2-yl)-2H-pyrrol-3-ol (PubChem CID 137178588) has the molecular formula C14H17N4O+ and a molecular weight of 257.32 g/mol. Its IUPAC name is 5-amino-4-(1-ethyl-3-methylbenzimidazol-3-ium-2-yl)-2H-pyrrol-3-ol.
| Compound Name | 5-amino-4-(1-ethyl-3-methylbenzimidazol-3-ium-2-yl)-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 137178588 |
| Molecular Formula | C14H17N4O+ |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 5-amino-4-(1-ethyl-3-methylbenzimidazol-3-ium-2-yl)-2H-pyrrol-3-ol |
| SMILES | CCn1c(C2=C(O)CN=C2N)[n+](C)c2ccccc21 |
| InChI | InChI=1S/C14H16N4O/c1-3-18-10-7-5-4-6-9(10)17(2)14(18)12-11(19)8-16-13(12)15/h4-7H,3,8H2,1-2H3,(H2,15,16)/p+1 |
| InChIKey | CASBWBACDXLPPB-UHFFFAOYSA-O |
| XLogP | 1.13 |
| TPSA | 67.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|