C16H15N3O3S — CID 135521631
3-(3-hydroxy-5-imino-4-phenyl-2H-pyrrol-1-yl)benzenesulfonamide (PubChem CID 135521631) has the molecular formula C16H15N3O3S and a molecular weight of 329.38 g/mol. Its IUPAC name is 3-(3-hydroxy-5-imino-4-phenyl-2H-pyrrol-1-yl)benzenesulfonamide.
| Compound Name | 3-(3-hydroxy-5-imino-4-phenyl-2H-pyrrol-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 135521631 |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 3-(3-hydroxy-5-imino-4-phenyl-2H-pyrrol-1-yl)benzenesulfonamide |
| SMILES | [H]/N=C1/C(c2ccccc2)=C(O)CN1c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C16H15N3O3S/c17-16-15(11-5-2-1-3-6-11)14(20)10-19(16)12-7-4-8-13(9-12)23(18,21)22/h1-9,17,20H,10H2,(H2,18,21,22)/b17-16- |
| InChIKey | LDBGOOOMIGZXDK-MSUUIHNZSA-N |
| XLogP | 2.10 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|