About 4-oxo-3H-1,2,3-benzotriazine-8-carboxamide
4-oxo-3H-1,2,3-benzotriazine-8-carboxamide (PubChem CID 135518053) has the molecular formula C8H6N4O2
and a molecular weight of 190.16 g/mol. Its IUPAC name is 4-oxo-3H-1,2,3-benzotriazine-8-carboxamide.
Molecular Properties
| Compound Name | 4-oxo-3H-1,2,3-benzotriazine-8-carboxamide |
| PubChem CID | 135518053 |
| Molecular Formula | C8H6N4O2 |
| Molecular Weight | 190.16 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | 4-oxo-3H-1,2,3-benzotriazine-8-carboxamide |
| SMILES | NC(=O)c1cccc2c(=O)[nH]nnc12 |
| InChI | InChI=1S/C8H6N4O2/c9-7(13)4-2-1-3-5-6(4)10-12-11-8(5)14/h1-3H,(H2,9,13)(H,10,11,14) |
| InChIKey | CFFIFXRBQJCGER-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.16 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-oxo-3H-1,2,3-benzotriazine-8-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-3H-1,2,3-benzotriazine-8-carboxamide?
The IUPAC name of 4-oxo-3H-1,2,3-benzotriazine-8-carboxamide (CID 135518053) is 4-oxo-3H-1,2,3-benzotriazine-8-carboxamide.
What is the SMILES notation for 4-oxo-3H-1,2,3-benzotriazine-8-carboxamide?
The canonical SMILES for 4-oxo-3H-1,2,3-benzotriazine-8-carboxamide is NC(=O)c1cccc2c(=O)[nH]nnc12.
What is the InChIKey of 4-oxo-3H-1,2,3-benzotriazine-8-carboxamide?
The InChIKey is CFFIFXRBQJCGER-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N4O2/c9-7(13)4-2-1-3-5-6(4)10-12-11-8(5)14/h1-3H,(H2,9,13)(H,10,11,14).
What are the key properties of 4-oxo-3H-1,2,3-benzotriazine-8-carboxamide?
4-oxo-3H-1,2,3-benzotriazine-8-carboxamide has a molecular weight of 190.16 g/mol, XLogP of -0.58, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-3H-1,2,3-benzotriazine-8-carboxamide is sourced from PubChem (CID 135518053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).