C33H36N4O5Zn — CID 135525459
zinc methyl (17S,18S)-7-ethyl-12-(hydroxymethyl)-18-(3-methoxy-3-oxopropyl)-3,8,13,17-tetramethyl-17,18-dihydroporphyrin-22,23-diide-2-carboxylate (PubChem CID 135525459) has the molecular formula C33H36N4O5Zn and a molecular weight of 634.06 g/mol. Its IUPAC name is zinc methyl (17S,18S)-7-ethyl-12-(hydroxymethyl)-18-(3-methoxy-3-oxopropyl)-3,8,13,17-tetramethyl-17,18-dihydroporphyrin-22,23-diide-2-carboxylate.
| Compound Name | zinc methyl (17S,18S)-7-ethyl-12-(hydroxymethyl)-18-(3-methoxy-3-oxopropyl)-3,8,13,17-tetramethyl-17,18-dihydroporphyrin-22,23-diide-2-carboxylate |
|---|---|
| PubChem CID | 135525459 |
| Molecular Formula | C33H36N4O5Zn |
| Molecular Weight | 634.06 g/mol |
| Exact Mass | 632.20 |
| IUPAC Name | zinc methyl (17S,18S)-7-ethyl-12-(hydroxymethyl)-18-(3-methoxy-3-oxopropyl)-3,8,13,17-tetramethyl-17,18-dihydroporphyrin-22,23-diide-2-carboxylate |
| SMILES | CCc1c(C)c2cc3[n-]c(cc4nc(cc5nc(cc1[n-]2)C(C)=C5C(=O)OC)[C@@H](CCC(=O)OC)[C@@H]4C)c(C)c3CO.[Zn+2] |
| InChI | InChI=1S/C33H37N4O5.Zn/c1-8-20-16(2)25-12-29-22(15-38)18(4)24(36-29)11-23-17(3)21(9-10-31(39)41-6)28(35-23)14-30-32(33(40)42-7)19(5)26(37-30)13-27(20)34-25;/h11-14,17,21,38H,8-10,15H2,1-7H3,(H-,34,35,36,37,40);/q-1;+2/p-1/t17-,21-;/m0./s1 |
| InChIKey | IZPOEGCPYVNJPY-PVMVIUQGSA-M |
| XLogP | 5.19 |
| TPSA | 126.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.06 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|