C14H13F3N5O4P — CID 135529934
[2-[2-[(2-amino-6-oxo-1H-purin-9-yl)methyl]phenyl]-1,1,2-trifluoroethyl]phosphonic acid (PubChem CID 135529934) has the molecular formula C14H13F3N5O4P and a molecular weight of 403.26 g/mol. Its IUPAC name is [2-[2-[(2-amino-6-oxo-1H-purin-9-yl)methyl]phenyl]-1,1,2-trifluoroethyl]phosphonic acid.
| Compound Name | [2-[2-[(2-amino-6-oxo-1H-purin-9-yl)methyl]phenyl]-1,1,2-trifluoroethyl]phosphonic acid |
|---|---|
| PubChem CID | 135529934 |
| Molecular Formula | C14H13F3N5O4P |
| Molecular Weight | 403.26 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | [2-[2-[(2-amino-6-oxo-1H-purin-9-yl)methyl]phenyl]-1,1,2-trifluoroethyl]phosphonic acid |
| SMILES | Nc1nc2c(ncn2Cc2ccccc2C(F)C(F)(F)P(=O)(O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C14H13F3N5O4P/c15-10(14(16,17)27(24,25)26)8-4-2-1-3-7(8)5-22-6-19-9-11(22)20-13(18)21-12(9)23/h1-4,6,10H,5H2,(H2,24,25,26)(H3,18,20,21,23) |
| InChIKey | CRQHLFRDYLIVLG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 147.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|