C30H35N5O5S — CID 135530649
3-[4-oxo-6-[3-(pyridin-2-ylamino)propyl]-3H-quinazolin-2-yl]-3-[(2,3,4,5,6-pentamethylphenyl)sulfonylamino]propanoic acid (PubChem CID 135530649) has the molecular formula C30H35N5O5S and a molecular weight of 577.71 g/mol. Its IUPAC name is 3-[4-oxo-6-[3-(pyridin-2-ylamino)propyl]-3H-quinazolin-2-yl]-3-[(2,3,4,5,6-pentamethylphenyl)sulfonylamino]propanoic acid.
| Compound Name | 3-[4-oxo-6-[3-(pyridin-2-ylamino)propyl]-3H-quinazolin-2-yl]-3-[(2,3,4,5,6-pentamethylphenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 135530649 |
| Molecular Formula | C30H35N5O5S |
| Molecular Weight | 577.71 g/mol |
| Exact Mass | 577.24 |
| IUPAC Name | 3-[4-oxo-6-[3-(pyridin-2-ylamino)propyl]-3H-quinazolin-2-yl]-3-[(2,3,4,5,6-pentamethylphenyl)sulfonylamino]propanoic acid |
| SMILES | Cc1c(C)c(C)c(S(=O)(=O)NC(CC(=O)O)c2nc3ccc(CCCNc4ccccn4)cc3c(=O)[nH]2)c(C)c1C |
| InChI | InChI=1S/C30H35N5O5S/c1-17-18(2)20(4)28(21(5)19(17)3)41(39,40)35-25(16-27(36)37)29-33-24-12-11-22(15-23(24)30(38)34-29)9-8-14-32-26-10-6-7-13-31-26/h6-7,10-13,15,25,35H,8-9,14,16H2,1-5H3,(H,31,32)(H,36,37)(H,33,34,38) |
| InChIKey | DMKVMYXLYJZZQD-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 154.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.71 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|