C40H50N4O10 — CID 135531394
5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-[(E)-3-[4-(diethylamino)-2-[(4-methoxyphenyl)methoxy]phenyl]-2-methylprop-2-enoyl]oxybenzoic acid (PubChem CID 135531394) has the molecular formula C40H50N4O10 and a molecular weight of 746.86 g/mol. Its IUPAC name is 5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-[(E)-3-[4-(diethylamino)-2-[(4-methoxyphenyl)methoxy]phenyl]-2-methylprop-2-enoyl]oxybenzoic acid.
| Compound Name | 5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-[(E)-3-[4-(diethylamino)-2-[(4-methoxyphenyl)methoxy]phenyl]-2-methylprop-2-enoyl]oxybenzoic acid |
|---|---|
| PubChem CID | 135531394 |
| Molecular Formula | C40H50N4O10 |
| Molecular Weight | 746.86 g/mol |
| Exact Mass | 746.35 |
| IUPAC Name | 5-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-[(E)-3-[4-(diethylamino)-2-[(4-methoxyphenyl)methoxy]phenyl]-2-methylprop-2-enoyl]oxybenzoic acid |
| SMILES | CCN(CC)c1ccc(/C=C(\C)C(=O)Oc2ccc(N=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)cc2C(=O)O)c(OCc2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C40H50N4O10/c1-11-44(12-2)29-17-15-27(33(23-29)51-24-26-13-18-30(50-10)19-14-26)21-25(3)35(47)52-32-20-16-28(22-31(32)34(45)46)41-36(42-37(48)53-39(4,5)6)43-38(49)54-40(7,8)9/h13-23H,11-12,24H2,1-10H3,(H,45,46)(H2,41,42,43,48,49)/b25-21+ |
| InChIKey | UZJJYIPLOWKXAK-NJNXFGOHSA-N |
| XLogP | 7.86 |
| TPSA | 174.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.86 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|