C16H13NO2S2 — CID 135538594
(3E,6S)-3-(hydroxymethylidene)-2-phenylimino-6-thiophen-2-ylthian-4-one (PubChem CID 135538594) has the molecular formula C16H13NO2S2 and a molecular weight of 315.42 g/mol. Its IUPAC name is (3E,6S)-3-(hydroxymethylidene)-2-phenylimino-6-thiophen-2-ylthian-4-one.
| Compound Name | (3E,6S)-3-(hydroxymethylidene)-2-phenylimino-6-thiophen-2-ylthian-4-one |
|---|---|
| PubChem CID | 135538594 |
| Molecular Formula | C16H13NO2S2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | (3E,6S)-3-(hydroxymethylidene)-2-phenylimino-6-thiophen-2-ylthian-4-one |
| SMILES | O=C1C[C@@H](c2cccs2)SC(=N\c2ccccc2)/C1=C/O |
| InChI | InChI=1S/C16H13NO2S2/c18-10-12-13(19)9-15(14-7-4-8-20-14)21-16(12)17-11-5-2-1-3-6-11/h1-8,10,15,18H,9H2/b12-10+,17-16-/t15-/m0/s1 |
| InChIKey | DQFYKTGMXLHPEW-FHKBERKFSA-N |
| XLogP | 4.67 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|