About N-[2-(N'-benzoylcarbamimidoyl)-3-hydroxybut-2-enethioyl]benzamide
N-[2-(N'-benzoylcarbamimidoyl)-3-hydroxybut-2-enethioyl]benzamide (PubChem CID 135541606) has the molecular formula C19H17N3O3S
and a molecular weight of 367.43 g/mol. Its IUPAC name is N-[2-(N'-benzoylcarbamimidoyl)-3-hydroxybut-2-enethioyl]benzamide.
Molecular Properties
| Compound Name | N-[2-(N'-benzoylcarbamimidoyl)-3-hydroxybut-2-enethioyl]benzamide |
| PubChem CID | 135541606 |
| Molecular Formula | C19H17N3O3S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | N-[2-(N'-benzoylcarbamimidoyl)-3-hydroxybut-2-enethioyl]benzamide |
| SMILES | CC(O)=C(C(=S)NC(=O)c1ccccc1)/C(N)=N/C(=O)c1ccccc1 |
| InChI | InChI=1S/C19H17N3O3S/c1-12(23)15(16(20)21-17(24)13-8-4-2-5-9-13)19(26)22-18(25)14-10-6-3-7-11-14/h2-11,23H,1H3,(H2,20,21,24)(H,22,25,26) |
| InChIKey | RFZYKLBTSXCTND-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(N'-benzoylcarbamimidoyl)-3-hydroxybut-2-enethioyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(N'-benzoylcarbamimidoyl)-3-hydroxybut-2-enethioyl]benzamide?
The IUPAC name of N-[2-(N'-benzoylcarbamimidoyl)-3-hydroxybut-2-enethioyl]benzamide (CID 135541606) is N-[2-(N'-benzoylcarbamimidoyl)-3-hydroxybut-2-enethioyl]benzamide.
What is the SMILES notation for N-[2-(N'-benzoylcarbamimidoyl)-3-hydroxybut-2-enethioyl]benzamide?
The canonical SMILES for N-[2-(N'-benzoylcarbamimidoyl)-3-hydroxybut-2-enethioyl]benzamide is CC(O)=C(C(=S)NC(=O)c1ccccc1)/C(N)=N/C(=O)c1ccccc1.
What is the InChIKey of N-[2-(N'-benzoylcarbamimidoyl)-3-hydroxybut-2-enethioyl]benzamide?
The InChIKey is RFZYKLBTSXCTND-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N3O3S/c1-12(23)15(16(20)21-17(24)13-8-4-2-5-9-13)19(26)22-18(25)14-10-6-3-7-11-14/h2-11,23H,1H3,(H2,20,21,24)(H,22,25,26).
What are the key properties of N-[2-(N'-benzoylcarbamimidoyl)-3-hydroxybut-2-enethioyl]benzamide?
N-[2-(N'-benzoylcarbamimidoyl)-3-hydroxybut-2-enethioyl]benzamide has a molecular weight of 367.43 g/mol, XLogP of 2.77, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(N'-benzoylcarbamimidoyl)-3-hydroxybut-2-enethioyl]benzamide is sourced from PubChem (CID 135541606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).