C29H31N3O2 — CID 135576654
1-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-3-[3-(4-methylphenyl)-1-adamantyl]urea (PubChem CID 135576654) has the molecular formula C29H31N3O2 and a molecular weight of 453.59 g/mol. Its IUPAC name is 1-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-3-[3-(4-methylphenyl)-1-adamantyl]urea.
| Compound Name | 1-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-3-[3-(4-methylphenyl)-1-adamantyl]urea |
|---|---|
| PubChem CID | 135576654 |
| Molecular Formula | C29H31N3O2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 1-[(E)-(2-hydroxynaphthalen-1-yl)methylideneamino]-3-[3-(4-methylphenyl)-1-adamantyl]urea |
| SMILES | Cc1ccc(C23CC4CC(CC(NC(=O)N/N=C/c5c(O)ccc6ccccc56)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C29H31N3O2/c1-19-6-9-23(10-7-19)28-13-20-12-21(14-28)16-29(15-20,18-28)31-27(34)32-30-17-25-24-5-3-2-4-22(24)8-11-26(25)33/h2-11,17,20-21,33H,12-16,18H2,1H3,(H2,31,32,34)/b30-17+ |
| InChIKey | ATQFPHRTURPXAZ-OCSSWDANSA-N |
| XLogP | 5.78 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|