C25H30N2O — CID 98173867
1-benzyl-3-[(5S,7S)-3-(4-methylphenyl)-1-adamantyl]urea (PubChem CID 98173867) has the molecular formula C25H30N2O and a molecular weight of 374.53 g/mol. Its IUPAC name is 1-benzyl-3-[(5S,7S)-3-(4-methylphenyl)-1-adamantyl]urea.
| Compound Name | 1-benzyl-3-[(5S,7S)-3-(4-methylphenyl)-1-adamantyl]urea |
|---|---|
| PubChem CID | 98173867 |
| Molecular Formula | C25H30N2O |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | 1-benzyl-3-[(5S,7S)-3-(4-methylphenyl)-1-adamantyl]urea |
| SMILES | Cc1ccc(C23C[C@@H]4C[C@H](CC(NC(=O)NCc5ccccc5)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C25H30N2O/c1-18-7-9-22(10-8-18)24-12-20-11-21(13-24)15-25(14-20,17-24)27-23(28)26-16-19-5-3-2-4-6-19/h2-10,20-21H,11-17H2,1H3,(H2,26,27,28)/t20-,21-,24?,25?/m0/s1 |
| InChIKey | OZVLHDOMIXNESC-SKGAXEKPSA-N |
| XLogP | 5.08 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |