C33H43N3O2 — CID 45022548
1-[(E)-(4-cyclooctyloxyphenyl)methylideneamino]-3-[3-(4-methylphenyl)-1-adamantyl]urea (PubChem CID 45022548) has the molecular formula C33H43N3O2 and a molecular weight of 513.73 g/mol. Its IUPAC name is 1-[(E)-(4-cyclooctyloxyphenyl)methylideneamino]-3-[3-(4-methylphenyl)-1-adamantyl]urea.
| Compound Name | 1-[(E)-(4-cyclooctyloxyphenyl)methylideneamino]-3-[3-(4-methylphenyl)-1-adamantyl]urea |
|---|---|
| PubChem CID | 45022548 |
| Molecular Formula | C33H43N3O2 |
| Molecular Weight | 513.73 g/mol |
| Exact Mass | 513.34 |
| IUPAC Name | 1-[(E)-(4-cyclooctyloxyphenyl)methylideneamino]-3-[3-(4-methylphenyl)-1-adamantyl]urea |
| SMILES | Cc1ccc(C23CC4CC(CC(NC(=O)N/N=C/c5ccc(OC6CCCCCCC6)cc5)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C33H43N3O2/c1-24-9-13-28(14-10-24)32-18-26-17-27(19-32)21-33(20-26,23-32)35-31(37)36-34-22-25-11-15-30(16-12-25)38-29-7-5-3-2-4-6-8-29/h9-16,22,26-27,29H,2-8,17-21,23H2,1H3,(H2,35,36,37)/b34-22+ |
| InChIKey | PUVNKBQWEGACHJ-PPOKSSTKSA-N |
| XLogP | 7.41 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.73 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|