C13H12N6O2S — CID 135585390
N'-carbamimidoyl-6-(3,4-dihydroxyphenyl)imidazo[2,1-b][1,3]thiazole-5-carboximidamide (PubChem CID 135585390) has the molecular formula C13H12N6O2S and a molecular weight of 316.35 g/mol. Its IUPAC name is N'-carbamimidoyl-6-(3,4-dihydroxyphenyl)imidazo[2,1-b][1,3]thiazole-5-carboximidamide.
| Compound Name | N'-carbamimidoyl-6-(3,4-dihydroxyphenyl)imidazo[2,1-b][1,3]thiazole-5-carboximidamide |
|---|---|
| PubChem CID | 135585390 |
| Molecular Formula | C13H12N6O2S |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | N'-carbamimidoyl-6-(3,4-dihydroxyphenyl)imidazo[2,1-b][1,3]thiazole-5-carboximidamide |
| SMILES | [H]/N=C(N)/N=C(\N)c1c(-c2ccc(O)c(O)c2)nc2sccn12 |
| InChI | InChI=1S/C13H12N6O2S/c14-11(18-12(15)16)10-9(17-13-19(10)3-4-22-13)6-1-2-7(20)8(21)5-6/h1-5,20-21H,(H5,14,15,16,18) |
| InChIKey | GTMMDDJQVFXZSM-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 146.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|