C13H13ClN6O2S — CID 135436458
N'-carbamimidoyl-6-(2,5-dihydroxyphenyl)imidazo[2,1-b][1,3]thiazole-5-carboximidamide;hydrochloride (PubChem CID 135436458) has the molecular formula C13H13ClN6O2S and a molecular weight of 352.81 g/mol. Its IUPAC name is N'-carbamimidoyl-6-(2,5-dihydroxyphenyl)imidazo[2,1-b][1,3]thiazole-5-carboximidamide;hydrochloride.
| Compound Name | N'-carbamimidoyl-6-(2,5-dihydroxyphenyl)imidazo[2,1-b][1,3]thiazole-5-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 135436458 |
| Molecular Formula | C13H13ClN6O2S |
| Molecular Weight | 352.81 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | N'-carbamimidoyl-6-(2,5-dihydroxyphenyl)imidazo[2,1-b][1,3]thiazole-5-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(N)/N=C(\N)c1c(-c2cc(O)ccc2O)nc2sccn12 |
| InChI | InChI=1S/C13H12N6O2S.ClH/c14-11(18-12(15)16)10-9(17-13-19(10)3-4-22-13)7-5-6(20)1-2-8(7)21;/h1-5,20-21H,(H5,14,15,16,18);1H |
| InChIKey | LHDAIQUFZHUUII-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 146.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.81 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|