About benzylsulfanylcarbamoylazanium;tetradecanoate
benzylsulfanylcarbamoylazanium;tetradecanoate (PubChem CID 135597261) has the molecular formula C22H38N2O3S
and a molecular weight of 410.62 g/mol. Its IUPAC name is benzylsulfanylcarbamoylazanium;tetradecanoate.
Molecular Properties
| Compound Name | benzylsulfanylcarbamoylazanium;tetradecanoate |
| PubChem CID | 135597261 |
| Molecular Formula | C22H38N2O3S |
| Molecular Weight | 410.62 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | benzylsulfanylcarbamoylazanium;tetradecanoate |
| SMILES | CCCCCCCCCCCCCC(=O)[O-].[NH3+]C(=O)NSCc1ccccc1 |
| InChI | InChI=1S/C14H28O2.C8H10N2OS/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;9-8(11)10-12-6-7-4-2-1-3-5-7/h2-13H2,1H3,(H,15,16);1-5H,6H2,(H3,9,10,11) |
| InChIKey | UUMDGWBKOAECDT-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.62 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzylsulfanylcarbamoylazanium;tetradecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzylsulfanylcarbamoylazanium;tetradecanoate?
The IUPAC name of benzylsulfanylcarbamoylazanium;tetradecanoate (CID 135597261) is benzylsulfanylcarbamoylazanium;tetradecanoate.
What is the SMILES notation for benzylsulfanylcarbamoylazanium;tetradecanoate?
The canonical SMILES for benzylsulfanylcarbamoylazanium;tetradecanoate is CCCCCCCCCCCCCC(=O)[O-].[NH3+]C(=O)NSCc1ccccc1.
What is the InChIKey of benzylsulfanylcarbamoylazanium;tetradecanoate?
The InChIKey is UUMDGWBKOAECDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O2.C8H10N2OS/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;9-8(11)10-12-6-7-4-2-1-3-5-7/h2-13H2,1H3,(H,15,16);1-5H,6H2,(H3,9,10,11).
What are the key properties of benzylsulfanylcarbamoylazanium;tetradecanoate?
benzylsulfanylcarbamoylazanium;tetradecanoate has a molecular weight of 410.62 g/mol, XLogP of 4.22, 15 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzylsulfanylcarbamoylazanium;tetradecanoate is sourced from PubChem (CID 135597261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).