C17H12N4O6 — CID 135600649
N-acetylimino-3-(1,3-dihydroxy-5-nitroisoindol-2-yl)benzamide (PubChem CID 135600649) has the molecular formula C17H12N4O6 and a molecular weight of 368.31 g/mol. Its IUPAC name is N-acetylimino-3-(1,3-dihydroxy-5-nitroisoindol-2-yl)benzamide.
| Compound Name | N-acetylimino-3-(1,3-dihydroxy-5-nitroisoindol-2-yl)benzamide |
|---|---|
| PubChem CID | 135600649 |
| Molecular Formula | C17H12N4O6 |
| Molecular Weight | 368.31 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | N-acetylimino-3-(1,3-dihydroxy-5-nitroisoindol-2-yl)benzamide |
| SMILES | CC(=O)/N=N/C(=O)c1cccc(-n2c(O)c3ccc([N+](=O)[O-])cc3c2O)c1 |
| InChI | InChI=1S/C17H12N4O6/c1-9(22)18-19-15(23)10-3-2-4-11(7-10)20-16(24)13-6-5-12(21(26)27)8-14(13)17(20)25/h2-8,24-25H,1H3/b19-18+ |
| InChIKey | WJPWDKFBJPBMCC-VHEBQXMUSA-N |
| XLogP | 3.09 |
| TPSA | 147.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|