C12H11N5O3S — CID 135609097
2-[[5-(methoxymethyl)furan-2-yl]methylideneamino]-8-sulfanylidene-7,9-dihydro-1H-purin-6-one (PubChem CID 135609097) has the molecular formula C12H11N5O3S and a molecular weight of 305.32 g/mol. Its IUPAC name is 2-[[5-(methoxymethyl)furan-2-yl]methylideneamino]-8-sulfanylidene-7,9-dihydro-1H-purin-6-one.
| Compound Name | 2-[[5-(methoxymethyl)furan-2-yl]methylideneamino]-8-sulfanylidene-7,9-dihydro-1H-purin-6-one |
|---|---|
| PubChem CID | 135609097 |
| Molecular Formula | C12H11N5O3S |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 2-[[5-(methoxymethyl)furan-2-yl]methylideneamino]-8-sulfanylidene-7,9-dihydro-1H-purin-6-one |
| SMILES | COCc1ccc(C=Nc2nc3[nH]c(=S)[nH]c3c(=O)[nH]2)o1 |
| InChI | InChI=1S/C12H11N5O3S/c1-19-5-7-3-2-6(20-7)4-13-11-15-9-8(10(18)17-11)14-12(21)16-9/h2-4H,5H2,1H3,(H3,14,15,16,17,18,21) |
| InChIKey | CKKKJGZFMPTILT-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|