C15H23N5O3S — CID 135612451
1-[(E)-[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea (PubChem CID 135612451) has the molecular formula C15H23N5O3S and a molecular weight of 353.45 g/mol. Its IUPAC name is 1-[(E)-[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 1-[(E)-[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 135612451 |
| Molecular Formula | C15H23N5O3S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 1-[(E)-[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methylideneamino]-3-(2-morpholin-4-ylethyl)thiourea |
| SMILES | Cc1ncc(CO)c(/C=N/NC(=S)NCCN2CCOCC2)c1O |
| InChI | InChI=1S/C15H23N5O3S/c1-11-14(22)13(12(10-21)8-17-11)9-18-19-15(24)16-2-3-20-4-6-23-7-5-20/h8-9,21-22H,2-7,10H2,1H3,(H2,16,19,24)/b18-9+ |
| InChIKey | AAVMRBOMBTYZIA-GIJQJNRQSA-N |
| XLogP | -0.28 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|