C25H24N2O4 — CID 135625508
tert-butyl (E)-3-hydroxy-2-[3-(3-phenylprop-2-enoylimino)isoindol-1-yl]but-2-enoate (PubChem CID 135625508) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is tert-butyl (E)-3-hydroxy-2-[3-(3-phenylprop-2-enoylimino)isoindol-1-yl]but-2-enoate.
| Compound Name | tert-butyl (E)-3-hydroxy-2-[3-(3-phenylprop-2-enoylimino)isoindol-1-yl]but-2-enoate |
|---|---|
| PubChem CID | 135625508 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | tert-butyl (E)-3-hydroxy-2-[3-(3-phenylprop-2-enoylimino)isoindol-1-yl]but-2-enoate |
| SMILES | C/C(O)=C(\C(=O)OC(C)(C)C)C1=N/C(=N\C(=O)C=Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C25H24N2O4/c1-16(28)21(24(30)31-25(2,3)4)22-18-12-8-9-13-19(18)23(27-22)26-20(29)15-14-17-10-6-5-7-11-17/h5-15,28H,1-4H3/b15-14?,21-16+,26-23- |
| InChIKey | AEGYVICOTWWLQA-YWOKFFCRSA-N |
| XLogP | 4.65 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|