C24H30N6O — CID 135638027
1-(3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl)-2-phenyl-2-(tetrazol-1-yl)ethanone (PubChem CID 135638027) has the molecular formula C24H30N6O and a molecular weight of 418.55 g/mol. Its IUPAC name is 1-(3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl)-2-phenyl-2-(tetrazol-1-yl)ethanone.
| Compound Name | 1-(3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl)-2-phenyl-2-(tetrazol-1-yl)ethanone |
|---|---|
| PubChem CID | 135638027 |
| Molecular Formula | C24H30N6O |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | 1-(3,15-diazatetracyclo[7.7.1.02,7.010,15]heptadec-7-en-3-yl)-2-phenyl-2-(tetrazol-1-yl)ethanone |
| SMILES | O=C(C(c1ccccc1)n1cnnn1)N1CCCC2=CC3CC(CN4CCCCC34)C21 |
| InChI | InChI=1S/C24H30N6O/c31-24(23(30-16-25-26-27-30)17-7-2-1-3-8-17)29-12-6-9-18-13-19-14-20(22(18)29)15-28-11-5-4-10-21(19)28/h1-3,7-8,13,16,19-23H,4-6,9-12,14-15H2 |
| InChIKey | DBNXODGUIPCCQD-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|