C18H21N7O5S — CID 135645628
4-[(E)-[3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methylsulfanyl]-5-methyl-1,2,4-triazol-4-yl]iminomethyl]-2,6-dimethoxyphenol (PubChem CID 135645628) has the molecular formula C18H21N7O5S and a molecular weight of 447.48 g/mol. Its IUPAC name is 4-[(E)-[3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methylsulfanyl]-5-methyl-1,2,4-triazol-4-yl]iminomethyl]-2,6-dimethoxyphenol.
| Compound Name | 4-[(E)-[3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methylsulfanyl]-5-methyl-1,2,4-triazol-4-yl]iminomethyl]-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 135645628 |
| Molecular Formula | C18H21N7O5S |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 4-[(E)-[3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methylsulfanyl]-5-methyl-1,2,4-triazol-4-yl]iminomethyl]-2,6-dimethoxyphenol |
| SMILES | COc1cc(/C=N/n2c(C)nnc2SCn2nc(C)c([N+](=O)[O-])c2C)cc(OC)c1O |
| InChI | InChI=1S/C18H21N7O5S/c1-10-16(25(27)28)11(2)23(22-10)9-31-18-21-20-12(3)24(18)19-8-13-6-14(29-4)17(26)15(7-13)30-5/h6-8,26H,9H2,1-5H3/b19-8+ |
| InChIKey | MADUIIQNEZZDIA-UFWORHAWSA-N |
| XLogP | 2.66 |
| TPSA | 142.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|