C14H14BrN7O2S2 — CID 71834236
1-(4-bromothiophen-2-yl)-N-[3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methylsulfanyl]-5-methyl-1,2,4-triazol-4-yl]methanimine (PubChem CID 71834236) has the molecular formula C14H14BrN7O2S2 and a molecular weight of 456.35 g/mol. Its IUPAC name is 1-(4-bromothiophen-2-yl)-N-[3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methylsulfanyl]-5-methyl-1,2,4-triazol-4-yl]methanimine.
| Compound Name | 1-(4-bromothiophen-2-yl)-N-[3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methylsulfanyl]-5-methyl-1,2,4-triazol-4-yl]methanimine |
|---|---|
| PubChem CID | 71834236 |
| Molecular Formula | C14H14BrN7O2S2 |
| Molecular Weight | 456.35 g/mol |
| Exact Mass | 454.98 |
| IUPAC Name | 1-(4-bromothiophen-2-yl)-N-[3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methylsulfanyl]-5-methyl-1,2,4-triazol-4-yl]methanimine |
| SMILES | Cc1nn(CSc2nnc(C)n2N=Cc2cc(Br)cs2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H14BrN7O2S2/c1-8-13(22(23)24)9(2)20(19-8)7-26-14-18-17-10(3)21(14)16-5-12-4-11(15)6-25-12/h4-6H,7H2,1-3H3 |
| InChIKey | OTEMGBOSSWFXBI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 104.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.35 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|