C9H11F2N7O2S — CID 7018646
3-(difluoromethyl)-5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methylsulfanyl]-1,2,4-triazol-4-amine (PubChem CID 7018646) has the molecular formula C9H11F2N7O2S and a molecular weight of 319.30 g/mol. Its IUPAC name is 3-(difluoromethyl)-5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methylsulfanyl]-1,2,4-triazol-4-amine.
| Compound Name | 3-(difluoromethyl)-5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methylsulfanyl]-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 7018646 |
| Molecular Formula | C9H11F2N7O2S |
| Molecular Weight | 319.30 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 3-(difluoromethyl)-5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methylsulfanyl]-1,2,4-triazol-4-amine |
| SMILES | Cc1nn(CSc2nnc(C(F)F)n2N)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H11F2N7O2S/c1-4-6(18(19)20)5(2)16(15-4)3-21-9-14-13-8(7(10)11)17(9)12/h7H,3,12H2,1-2H3 |
| InChIKey | UDSNNHAUPITKHR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|