C15H19N9O2S — CID 19586618
(E)-N-[3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methylsulfanyl]-5-methyl-1,2,4-triazol-4-yl]-1-(1-ethylpyrazol-3-yl)methanimine (PubChem CID 19586618) has the molecular formula C15H19N9O2S and a molecular weight of 389.45 g/mol. Its IUPAC name is (E)-N-[3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methylsulfanyl]-5-methyl-1,2,4-triazol-4-yl]-1-(1-ethylpyrazol-3-yl)methanimine.
| Compound Name | (E)-N-[3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methylsulfanyl]-5-methyl-1,2,4-triazol-4-yl]-1-(1-ethylpyrazol-3-yl)methanimine |
|---|---|
| PubChem CID | 19586618 |
| Molecular Formula | C15H19N9O2S |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | (E)-N-[3-[(3,5-dimethyl-4-nitropyrazol-1-yl)methylsulfanyl]-5-methyl-1,2,4-triazol-4-yl]-1-(1-ethylpyrazol-3-yl)methanimine |
| SMILES | CCn1ccc(/C=N/n2c(C)nnc2SCn2nc(C)c([N+](=O)[O-])c2C)n1 |
| InChI | InChI=1S/C15H19N9O2S/c1-5-21-7-6-13(20-21)8-16-23-12(4)17-18-15(23)27-9-22-11(3)14(24(25)26)10(2)19-22/h6-8H,5,9H2,1-4H3/b16-8+ |
| InChIKey | MTRCNQAIJLFXLG-LZYBPNLTSA-N |
| XLogP | 2.16 |
| TPSA | 121.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|