C14H14Br2N6O2S2 — CID 4773949
3-(4,5-dibromothiophen-2-yl)-5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methylsulfanyl]-4-ethyl-1,2,4-triazole (PubChem CID 4773949) has the molecular formula C14H14Br2N6O2S2 and a molecular weight of 522.25 g/mol. Its IUPAC name is 3-(4,5-dibromothiophen-2-yl)-5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methylsulfanyl]-4-ethyl-1,2,4-triazole.
| Compound Name | 3-(4,5-dibromothiophen-2-yl)-5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methylsulfanyl]-4-ethyl-1,2,4-triazole |
|---|---|
| PubChem CID | 4773949 |
| Molecular Formula | C14H14Br2N6O2S2 |
| Molecular Weight | 522.25 g/mol |
| Exact Mass | 519.90 |
| IUPAC Name | 3-(4,5-dibromothiophen-2-yl)-5-[(3,5-dimethyl-4-nitropyrazol-1-yl)methylsulfanyl]-4-ethyl-1,2,4-triazole |
| SMILES | CCn1c(SCn2nc(C)c([N+](=O)[O-])c2C)nnc1-c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C14H14Br2N6O2S2/c1-4-20-13(10-5-9(15)12(16)26-10)17-18-14(20)25-6-21-8(3)11(22(23)24)7(2)19-21/h5H,4,6H2,1-3H3 |
| InChIKey | DYMMGDFBVYPCPR-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 91.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.25 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|