C18H17N7O6 — CID 135684510
3-[(E)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2-(2-hydroxyethylamino)-9-methylpyrido[1,2-a]pyrimidin-4-one (PubChem CID 135684510) has the molecular formula C18H17N7O6 and a molecular weight of 427.38 g/mol. Its IUPAC name is 3-[(E)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2-(2-hydroxyethylamino)-9-methylpyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-[(E)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2-(2-hydroxyethylamino)-9-methylpyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 135684510 |
| Molecular Formula | C18H17N7O6 |
| Molecular Weight | 427.38 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 3-[(E)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2-(2-hydroxyethylamino)-9-methylpyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1cccn2c(=O)c(/C=N/Nc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])c(NCCO)nc12 |
| InChI | InChI=1S/C18H17N7O6/c1-11-3-2-7-23-17(11)21-16(19-6-8-26)13(18(23)27)10-20-22-14-5-4-12(24(28)29)9-15(14)25(30)31/h2-5,7,9-10,19,22,26H,6,8H2,1H3/b20-10+ |
| InChIKey | KLDGJEIKGRUIQL-KEBDBYFISA-N |
| XLogP | 1.67 |
| TPSA | 177.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|