C11H11N5O5S — CID 135709638
4-methyl-N'-(5-nitro-6-oxo-1H-pyrimidin-4-yl)benzenesulfonohydrazide (PubChem CID 135709638) has the molecular formula C11H11N5O5S and a molecular weight of 325.31 g/mol. Its IUPAC name is 4-methyl-N'-(5-nitro-6-oxo-1H-pyrimidin-4-yl)benzenesulfonohydrazide.
| Compound Name | 4-methyl-N'-(5-nitro-6-oxo-1H-pyrimidin-4-yl)benzenesulfonohydrazide |
|---|---|
| PubChem CID | 135709638 |
| Molecular Formula | C11H11N5O5S |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 4-methyl-N'-(5-nitro-6-oxo-1H-pyrimidin-4-yl)benzenesulfonohydrazide |
| SMILES | Cc1ccc(S(=O)(=O)NNc2nc[nH]c(=O)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H11N5O5S/c1-7-2-4-8(5-3-7)22(20,21)15-14-10-9(16(18)19)11(17)13-6-12-10/h2-6,15H,1H3,(H2,12,13,14,17) |
| InChIKey | QXXGMWXJPCBDDJ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 147.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|