C21H20N4O2S3 — CID 135718253
6-[4-hydroxy-5-[(Z)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]-N-(1,3-thiazol-2-yl)hexanamide (PubChem CID 135718253) has the molecular formula C21H20N4O2S3 and a molecular weight of 456.62 g/mol. Its IUPAC name is 6-[4-hydroxy-5-[(Z)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]-N-(1,3-thiazol-2-yl)hexanamide.
| Compound Name | 6-[4-hydroxy-5-[(Z)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]-N-(1,3-thiazol-2-yl)hexanamide |
|---|---|
| PubChem CID | 135718253 |
| Molecular Formula | C21H20N4O2S3 |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | 6-[4-hydroxy-5-[(Z)-indol-3-ylidenemethyl]-2-sulfanylidene-1,3-thiazol-3-yl]-N-(1,3-thiazol-2-yl)hexanamide |
| SMILES | O=C(CCCCCn1c(O)c(/C=C2\C=Nc3ccccc32)sc1=S)Nc1nccs1 |
| InChI | InChI=1S/C21H20N4O2S3/c26-18(24-20-22-9-11-29-20)8-2-1-5-10-25-19(27)17(30-21(25)28)12-14-13-23-16-7-4-3-6-15(14)16/h3-4,6-7,9,11-13,27H,1-2,5,8,10H2,(H,22,24,26)/b14-12+ |
| InChIKey | QGWCBMNECDNVNE-WYMLVPIESA-N |
| XLogP | 5.90 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|