C20H15Cl2N5OS — CID 135718431
(2E)-2-[[1-[(2,4-dichlorophenyl)methyl]-3-phenylpyrazol-4-yl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135718431) has the molecular formula C20H15Cl2N5OS and a molecular weight of 444.35 g/mol. Its IUPAC name is (2E)-2-[[1-[(2,4-dichlorophenyl)methyl]-3-phenylpyrazol-4-yl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E)-2-[[1-[(2,4-dichlorophenyl)methyl]-3-phenylpyrazol-4-yl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135718431 |
| Molecular Formula | C20H15Cl2N5OS |
| Molecular Weight | 444.35 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | (2E)-2-[[1-[(2,4-dichlorophenyl)methyl]-3-phenylpyrazol-4-yl]methylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1CS/C(=N/N=Cc2cn(Cc3ccc(Cl)cc3Cl)nc2-c2ccccc2)N1 |
| InChI | InChI=1S/C20H15Cl2N5OS/c21-16-7-6-14(17(22)8-16)10-27-11-15(9-23-25-20-24-18(28)12-29-20)19(26-27)13-4-2-1-3-5-13/h1-9,11H,10,12H2,(H,24,25,28) |
| InChIKey | SAABAFYUGUDOOF-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 71.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.35 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|