C27H19Cl3N4O — CID 3744706
2-(3-chlorophenyl)-4-[[1-[(2,4-dichlorophenyl)methyl]-3-phenylpyrazol-4-yl]methylidene]-5-methylpyrazol-3-one (PubChem CID 3744706) has the molecular formula C27H19Cl3N4O and a molecular weight of 521.84 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-4-[[1-[(2,4-dichlorophenyl)methyl]-3-phenylpyrazol-4-yl]methylidene]-5-methylpyrazol-3-one.
| Compound Name | 2-(3-chlorophenyl)-4-[[1-[(2,4-dichlorophenyl)methyl]-3-phenylpyrazol-4-yl]methylidene]-5-methylpyrazol-3-one |
|---|---|
| PubChem CID | 3744706 |
| Molecular Formula | C27H19Cl3N4O |
| Molecular Weight | 521.84 g/mol |
| Exact Mass | 520.06 |
| IUPAC Name | 2-(3-chlorophenyl)-4-[[1-[(2,4-dichlorophenyl)methyl]-3-phenylpyrazol-4-yl]methylidene]-5-methylpyrazol-3-one |
| SMILES | CC1=NN(c2cccc(Cl)c2)C(=O)C1=Cc1cn(Cc2ccc(Cl)cc2Cl)nc1-c1ccccc1 |
| InChI | InChI=1S/C27H19Cl3N4O/c1-17-24(27(35)34(31-17)23-9-5-8-21(28)13-23)12-20-16-33(15-19-10-11-22(29)14-25(19)30)32-26(20)18-6-3-2-4-7-18/h2-14,16H,15H2,1H3 |
| InChIKey | QZAOCQBXQMPBNN-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.84 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|