C28H19Cl3N4O3 — CID 3317852
2-chloro-5-[4-[[1-[(2,4-dichlorophenyl)methyl]-3-phenylpyrazol-4-yl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid (PubChem CID 3317852) has the molecular formula C28H19Cl3N4O3 and a molecular weight of 565.84 g/mol. Its IUPAC name is 2-chloro-5-[4-[[1-[(2,4-dichlorophenyl)methyl]-3-phenylpyrazol-4-yl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid.
| Compound Name | 2-chloro-5-[4-[[1-[(2,4-dichlorophenyl)methyl]-3-phenylpyrazol-4-yl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 3317852 |
| Molecular Formula | C28H19Cl3N4O3 |
| Molecular Weight | 565.84 g/mol |
| Exact Mass | 564.05 |
| IUPAC Name | 2-chloro-5-[4-[[1-[(2,4-dichlorophenyl)methyl]-3-phenylpyrazol-4-yl]methylidene]-3-methyl-5-oxopyrazol-1-yl]benzoic acid |
| SMILES | CC1=NN(c2ccc(Cl)c(C(=O)O)c2)C(=O)C1=Cc1cn(Cc2ccc(Cl)cc2Cl)nc1-c1ccccc1 |
| InChI | InChI=1S/C28H19Cl3N4O3/c1-16-22(27(36)35(32-16)21-9-10-24(30)23(13-21)28(37)38)11-19-15-34(14-18-7-8-20(29)12-25(18)31)33-26(19)17-5-3-2-4-6-17/h2-13,15H,14H2,1H3,(H,37,38) |
| InChIKey | ZGPUBBVIXNMZPO-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.84 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|