C15H16ClNO4S — CID 135719190
(6-chloro-1,3-benzodioxol-5-yl)methyl (Z)-2-acetyl-3-hydroxy-N-methylbut-2-enimidothioate (PubChem CID 135719190) has the molecular formula C15H16ClNO4S and a molecular weight of 341.82 g/mol. Its IUPAC name is (6-chloro-1,3-benzodioxol-5-yl)methyl (Z)-2-acetyl-3-hydroxy-N-methylbut-2-enimidothioate.
| Compound Name | (6-chloro-1,3-benzodioxol-5-yl)methyl (Z)-2-acetyl-3-hydroxy-N-methylbut-2-enimidothioate |
|---|---|
| PubChem CID | 135719190 |
| Molecular Formula | C15H16ClNO4S |
| Molecular Weight | 341.82 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | (6-chloro-1,3-benzodioxol-5-yl)methyl (Z)-2-acetyl-3-hydroxy-N-methylbut-2-enimidothioate |
| SMILES | C/N=C(SCc1cc2c(cc1Cl)OCO2)\C(C(C)=O)=C(\C)O |
| InChI | InChI=1S/C15H16ClNO4S/c1-8(18)14(9(2)19)15(17-3)22-6-10-4-12-13(5-11(10)16)21-7-20-12/h4-5,18H,6-7H2,1-3H3/b14-8-,17-15+ |
| InChIKey | MQIFDKHVDCEVMZ-VEVMYOGCSA-N |
| XLogP | 3.75 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.82 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|